CAS 34784-05-9
:6-Bromoisoquinoline
Description:
6-Bromoisoquinoline is a heterocyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position of the isoquinoline ring significantly influences its chemical properties and reactivity. This compound typically appears as a pale yellow to brown solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and dichloromethane. 6-Bromoisoquinoline is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. It can serve as a building block in the synthesis of various pharmaceuticals and agrochemicals. The compound's reactivity can be attributed to the electron-withdrawing nature of the bromine substituent, which can facilitate electrophilic substitution reactions. Additionally, its structural features allow for potential interactions with biological targets, making it a subject of research in drug development. As with many brominated compounds, appropriate safety measures should be taken when handling 6-bromoisoquinoline due to its potential toxicity and environmental impact.
Formula:C9H6BrN
InChI:InChI=1S/C9H6BrN/c10-9-2-1-8-6-11-4-3-7(8)5-9/h1-6H
InChI key:InChIKey=ZTEATMVVGQUULZ-UHFFFAOYSA-N
SMILES:BrC1=CC2=C(C=C1)C=NC=C2
Synonyms:- (Isoquinolin-6-yl)bromide
- 6-Bromo-isoquinoline
- Isoquinoline, 6-bromo-
- NSC 229320
- 6-Bromoisoquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Bromoisoquinoline
CAS:Formula:C9H6BrNPurity:>98.0%(GC)Color and Shape:White - Yellow Solid FormMolecular weight:208.066-Bromoisoquinoline
CAS:6-BromoisoquinolineFormula:C9H6BrNPurity:97%Color and Shape:SolidMolecular weight:208.054646-Bromoisoquinoline
CAS:6-Bromoisoquinoline is a tetradentate ligand that can be used as a molecular model to study the binding of metal ions and organic molecules. 6-Bromoisoquinoline has been shown to bind covalently and noncovalently with phosphate groups on the surface of Caco-2 cells and to induce surface-enhanced Raman spectroscopy. This ligand has a high nucleophilicity and reacts readily with chloride, which is an acidic functional group. The reaction products are hydrochloric acid, trifluoroacetic acid, or both. 6-Bromoisoquinoline can also act as an allosteric modulator in some enzymes, such as phosphofructokinase in glycolysis.
Formula:C9H6BrNPurity:Min. 95%Molecular weight:208.05 g/mol





