CAS 347841-78-5

1,10-Decane-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-d20-diol(9CI)

Description:

1,10-Decane-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-d20-diol, also known by its CAS number 347841-78-5, is a synthetic organic compound characterized by its long carbon chain and multiple hydroxyl (-OH) functional groups. This compound features a decane backbone, which consists of ten carbon atoms, and is fully deuterated at the hydroxyl positions, indicating that the hydrogen atoms have been replaced with deuterium, a stable isotope of hydrogen. The presence of multiple hydroxyl groups suggests that it exhibits properties typical of polyols, including high solubility in water and potential for hydrogen bonding. Its structure may confer unique physical and chemical properties, making it useful in various applications, including as a reagent in organic synthesis or as a standard in analytical chemistry. Additionally, the deuteration can enhance its stability and alter its reactivity compared to its non-deuterated counterparts, making it a valuable compound for research in fields such as biochemistry and pharmacology.

Formula: C₁₀H₂D₂₀O₂

InChI: InChI=1S/C10H22O2/c11-9-7-5-3-1-2-4-6-8-10-12/h11-12H,1-10H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2

InChI key: FOTKYAAJKYLFFN-KHKAULECSA-N

SMILES: [2H]C([2H])(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O

Synonyms:

• 1,10-Decane-D20-Diol

1,10-Decane-d20-diol

CAS: 112-47-0, 347841-78-5

Formula: HO(CD₂)₁₀OH

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 194.28751

Ref: 3U-D3250

1,10-Decane-d20-diol

Controlled Product

CAS: 347841-78-5

Applications 1,10-Decane-d20-diol (CAS# 347841-78-5) is a useful isotopically labeled research compound.

Formula: C₁₀D₂₀H₂O₂

Color and Shape: Neat

Molecular weight: 194.4037

Ref: TR-D226341