CymitQuimica logo

CAS 348-25-4

:

6-Fluoro-1H-indazole

Description:
6-Fluoro-1H-indazole is a heterocyclic organic compound characterized by its indazole structure, which consists of a fused benzene and pyrazole ring. The presence of a fluorine atom at the 6-position of the indazole ring significantly influences its chemical properties, including its reactivity and potential biological activity. This compound is typically a white to off-white solid and is known for its moderate solubility in organic solvents. It has applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The fluorine substitution can enhance lipophilicity and metabolic stability, making it a valuable scaffold in drug design. Additionally, 6-Fluoro-1H-indazole may exhibit various pharmacological activities, including anti-inflammatory and anticancer properties, although specific biological effects can vary based on the context of its use. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C7H5FN2
InChI:InChI=1/C7H5FN2/c8-6-2-1-5-4-9-10-7(5)3-6/h1-4H,(H,9,10)
InChI key:CFMZDEQEVCDMRN-UHFFFAOYSA-N
SMILES:c1cc(cc2c1c[nH]n2)F
Synonyms:
  • 1H-indazole, 6-fluoro-
  • 6-Fluoro (1H)Indazole
Found 5 products.