CymitQuimica logo

CAS 348125-25-7

:

1,3-dioxo-2-(pyridin-3-ylmethyl)-2,3-dihydro-1H-isoindole-5-carboxylic acid

Description:
1,3-Dioxo-2-(pyridin-3-ylmethyl)-2,3-dihydro-1H-isoindole-5-carboxylic acid is a complex organic compound characterized by its unique structural features, which include a fused isoindole ring system and a pyridine moiety. This compound typically exhibits a range of functional groups, including carboxylic acid and diketone functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of the pyridine ring may impart specific electronic properties, influencing its behavior in chemical reactions and interactions with biological systems. Additionally, the compound may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The compound's stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations for its practical applications. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C15H10N2O4
InChI:InChI=1/C15H10N2O4/c18-13-11-4-3-10(15(20)21)6-12(11)14(19)17(13)8-9-2-1-5-16-7-9/h1-7H,8H2,(H,20,21)
SMILES:c1cc(cnc1)CN1C(=O)c2ccc(cc2C1=O)C(=O)O
Synonyms:
  • 1,3-Dioxo-2-(pyridin-3-ylmethyl)isoindoline-5-carboxylic acid
  • 1H-Isoindole-5-carboxylic acid, 2,3-dihydro-1,3-dioxo-2-(3-pyridinylmethyl)-
Found 2 products.