CymitQuimica logo

CAS 34888-05-6

:

(Trichloromethoxy)benzene

Description:
(Trichloromethoxy)benzene, also known by its CAS number 34888-05-6, is an organic compound characterized by the presence of a benzene ring substituted with a trichloromethoxy group. This compound typically exhibits a colorless to pale yellow liquid form and is known for its aromatic properties. The presence of chlorine atoms contributes to its reactivity and potential applications in various chemical processes, including as an intermediate in organic synthesis. Its molecular structure indicates that it may have significant dipole moments due to the electronegative chlorine atoms, influencing its solubility and interaction with other substances. (Trichloromethoxy)benzene is generally handled with caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures during use. Additionally, it may undergo reactions such as nucleophilic substitution or electrophilic aromatic substitution, making it a valuable compound in the synthesis of more complex organic molecules. As with many chlorinated compounds, it is important to consider its regulatory status and environmental implications in industrial applications.
Formula:C7H5Cl3O
InChI:InChI=1S/C7H5Cl3O/c8-7(9,10)11-6-4-2-1-3-5-6/h1-5H
InChI key:InChIKey=CLYZNABPUKUSDX-UHFFFAOYSA-N
SMILES:O(C(Cl)(Cl)Cl)C1=CC=CC=C1
Synonyms:
  • Phenyl trichloromethyl ether
  • (Trichloromethoxy)benzene
  • Anisole, α,α,α-trichloro-
  • Trichloromethyl phenyl ether
  • Benzene, (trichloromethoxy)-
Found 1 products.