CymitQuimica logo

CAS 34919-31-8

:

rel-(1R,2R)-2-(3-Methoxyphenyl)cyclopropanecarboxylic acid

Description:
Rel-(1R,2R)-2-(3-Methoxyphenyl)cyclopropanecarboxylic acid is a cyclopropane derivative characterized by its unique three-membered ring structure, which contributes to its distinct chemical properties. This compound features a carboxylic acid functional group, which imparts acidity and enhances its reactivity in various chemical reactions. The presence of the 3-methoxyphenyl group introduces an aromatic character, influencing the compound's solubility and interaction with biological systems. The stereochemistry indicated by the (1R,2R) configuration suggests specific spatial arrangements of the substituents, which can affect the compound's biological activity and pharmacokinetics. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the molecular structure allows for potential interactions with enzymes or receptors, which could be explored in drug development. Overall, rel-(1R,2R)-2-(3-Methoxyphenyl)cyclopropanecarboxylic acid represents a compound with significant potential for research in both synthetic and medicinal chemistry contexts.
Formula:C11H12O3
InChI:InChI=1/C11H12O3/c1-14-8-4-2-3-7(5-8)9-6-10(9)11(12)13/h2-5,9-10H,6H2,1H3,(H,12,13)/t9-,10+/s2
InChI key:InChIKey=SEQTZPLHSZFWIY-NLJMKPLXNA-N
SMILES:C(O)(=O)[C@H]1[C@@H](C1)C2=CC(OC)=CC=C2
Synonyms:
  • Cyclopropanecarboxylic acid, 2-(3-methoxyphenyl)-, (1R,2R)-rel-
  • rel-(1R,2R)-2-(3-Methoxyphenyl)cyclopropanecarboxylic acid
  • Cyclopropanecarboxylic acid, 2-(3-methoxyphenyl)-, trans-
Found 4 products.