CAS 349553-92-0

Undecane-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-d23,11-bromo- (9CI)

Description:

Undecane-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-d23,11-bromo- is a brominated alkane, specifically a derivative of undecane, which is a straight-chain hydrocarbon with eleven carbon atoms. This compound features multiple deuterium isotopes, indicated by the "d23" in its name, suggesting that several hydrogen atoms have been replaced with deuterium, a heavier isotope of hydrogen. The presence of bromine in the structure introduces significant reactivity, particularly in substitution reactions, making it useful in various chemical applications, including organic synthesis and as a potential tracer in studies involving hydrogen isotope effects. The compound's physical properties, such as boiling point and solubility, are influenced by its molecular weight and the presence of bromine, which typically increases polarity compared to non-brominated hydrocarbons. As with many brominated compounds, it is essential to handle this substance with care due to potential environmental and health impacts associated with brominated organic compounds.

Formula: C₁₁BrD₂₃

InChI: InChI=1S/C11H23Br/c1-2-3-4-5-6-7-8-9-10-11-12/h2-11H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2

InChI key: IKPSIIAXIDAQLG-SJTGVFOPSA-N

SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br

Synonyms:

• 1-Bromoundecane-D23

1-Bromoundecane-d23

CAS: 349553-92-0, 693-67-4

Formula: CD₃(CD₂)₁₀Br

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 257.24268

Ref: 3U-D4014

1-Bromoundecane-d23

Controlled Product

CAS: 349553-92-0

Applications 1-Bromoundecane-d23 (CAS# 349553-92-0) is a useful isotopically labeled research compound.

Formula: C₁₁D₂₃Br

Color and Shape: Neat

Molecular weight: 258.346

Ref: TR-B688437