CAS 34970-00-8
:bromo(chloro)iodomethane
Description:
Bromo(chloro)iodomethane, with the CAS number 34970-00-8, is a halogenated organic compound characterized by the presence of three halogen atoms: bromine, chlorine, and iodine, attached to a methane backbone. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively high density compared to water. It is soluble in organic solvents but has limited solubility in water. Bromo(chloro)iodomethane is primarily used in organic synthesis and as a reagent in various chemical reactions, particularly in the field of medicinal chemistry and material science. Its halogenated nature imparts unique reactivity, making it useful in substitution reactions and as a potential building block for more complex molecules. However, due to the presence of halogens, it may pose environmental and health risks, necessitating careful handling and disposal. As with many halogenated compounds, it is important to consider its potential for bioaccumulation and toxicity in aquatic environments.
Formula:CHBrClI
InChI:InChI=1/CHBrClI/c2-1(3)4/h1H
SMILES:C(Br)(Cl)I
Synonyms:- Bromochloroiodomethane
- Methane, Bromochloroiodo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Bromochloroiodomethane
CAS:Controlled ProductApplications Bromochloroiodomethane was found as a disinfection byproducts in European drinking water.
References Jeong, C.H., et al.: Environ. Sci. Technol. 46, 12120 (2012); Krasner, S.W., et al.: Proceed. Water. Qual. Technol. Confer., 1592 (2001);Formula:CHBrClIPurity:>90%Color and Shape:NeatMolecular weight:255.28Bromochloroiodomethane
CAS:Bromochloroiodomethane is a halogenated organic compound that is used as an analytical reagent for the introduction of fluorine into organic compounds. Bromochloroiodomethane is also used in analytical toxicology to determine the effects of various substances on kidney cells. The high concentrations of bromochloroiodomethane are activated to produce acid formation in mammalian cells and mammalian cell toxicity.
Formula:CHBrClIPurity:90%MinMolecular weight:255.28 g/mol


