CAS 350-35-6
:1-(1,2-Dibromoethyl)-4-fluorobenzene
Description:
1-(1,2-Dibromoethyl)-4-fluorobenzene, with the CAS number 350-35-6, is an organic compound characterized by its aromatic structure and the presence of both bromine and fluorine substituents. This compound features a fluorobenzene ring, where a fluorine atom is attached to the para position relative to a 1,2-dibromoethyl group. The presence of the dibromoethyl moiety introduces significant reactivity due to the electrophilic nature of the bromine atoms, making it a potential intermediate in various organic synthesis reactions. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is important to handle this substance with care, as both brominated and fluorinated compounds can exhibit toxicity and environmental persistence. Additionally, its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the sample. Overall, 1-(1,2-Dibromoethyl)-4-fluorobenzene serves as a valuable compound in chemical research and synthesis.
Formula:C8H7Br2F
InChI:InChI=1S/C8H7Br2F/c9-5-8(10)6-1-3-7(11)4-2-6/h1-4,8H,5H2
InChI key:InChIKey=XLXVBBKYOWCLMG-UHFFFAOYSA-N
SMILES:C(CBr)(Br)C1=CC=C(F)C=C1
Synonyms:- 1-(1,2-Dibromoethyl)-4-fluorobenzene
- 1-(p-Fluorophenyl)-1,2-dibromoethane
- 1-(α,β-Dibromoethyl)-4-fluorobenzene
- Benzene, 1-(1,2-Dibromoethyl)-4-Fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
