CymitQuimica logo

CAS 350597-49-8

:

methyl 5-chloro-2-methylnicotinate

Description:
Methyl 5-chloro-2-methylnicotinate is an organic compound that belongs to the class of nicotinic acid derivatives. It features a pyridine ring, which is characteristic of nicotinic compounds, and is substituted with a chlorine atom at the 5-position and a methyl group at the 2-position. This compound is typically a colorless to light yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. Methyl 5-chloro-2-methylnicotinate may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds that interact with nicotinic receptors. Its chemical structure allows for potential applications in medicinal chemistry, agrochemicals, and as a building block in organic synthesis. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C8H8ClNO2
InChI:InChI=1/C8H8ClNO2/c1-5-7(8(11)12-2)3-6(9)4-10-5/h3-4H,1-2H3
InChI key:KYEIGXOFICMHDP-UHFFFAOYSA-N
SMILES:Cc1c(cc(cn1)Cl)C(=O)OC
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-chloro-2-methyl-, methyl ester
  • Methyl 5-Chloro-2-Methylpyridine-3-Carboxylate
Found 4 products.