CAS 3508-94-9: 3-Methyl-2-phenylbutanoic acid
Description:3-Methyl-2-phenylbutanoic acid, with the CAS number 3508-94-9, is an organic compound classified as a carboxylic acid. It features a branched alkyl chain and an aromatic phenyl group, contributing to its unique structural characteristics. The molecular formula typically includes carbon, hydrogen, and oxygen atoms, reflecting its classification. This compound is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its physical properties may include a specific melting point and boiling point, which are influenced by its molecular structure and intermolecular forces. Additionally, 3-Methyl-2-phenylbutanoic acid may exhibit moderate solubility in organic solvents while being less soluble in water, a common trait among carboxylic acids. The presence of both aliphatic and aromatic components in its structure can affect its reactivity, making it a subject of interest in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-8(2)10(11(12)13)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,12,13)
InChI key:InChIKey=HDLQGISFYDYWFJ-UHFFFAOYSA-N
SMILES:O=C(O)C(C=1C=CC=CC1)C(C)C
- Synonyms:
- (2S)-3-methyl-2-phenylbutanoate
- (RS)-2-Phenyl-3-methylbutanoic acid
- (±)-2-Phenyl-3-methylbutyric acid
- (±)-α-Isopropylphenylacetic acid
- 2-Isopropyl-2-phenylacetic acid
- 2-Phenyl-3-methylbutanoic acid
- 3-Methyl-2-Phenylbutanoic Acid
- 3-Methyl-2-phenylbutyric acid
- Benzeneacetic acid, α-(1-methylethyl)-
- Butyric acid, 3-methyl-2-phenyl-
- See more synonyms
- NSC 22982
- α-(1-Methylethyl)benzeneacetic acid
