CAS 350818-61-0

Benzene-1,2,4-d3,3,5,6-tri(methyl-d3)- (9CI)

Description:

Benzene-1,2,4-d3,3,5,6-tri(methyl-d3) is a deuterated derivative of benzene, specifically a substituted aromatic compound where three methyl groups are replaced with deuterated methyl groups (methyl-d3). This compound is characterized by its stable aromatic ring structure, which contributes to its chemical stability and unique reactivity patterns. The presence of deuterium, a heavier isotope of hydrogen, enhances its mass spectrometric properties, making it useful in various analytical applications, including NMR spectroscopy and kinetic studies. The deuterated methyl groups can influence the compound's physical properties, such as boiling and melting points, compared to its non-deuterated counterparts. Additionally, the compound's structure allows for potential applications in research fields such as medicinal chemistry and materials science, where isotopic labeling can provide insights into reaction mechanisms and molecular interactions. Overall, Benzene-1,2,4-d3,3,5,6-tri(methyl-d3) serves as a valuable tool in both synthetic and analytical chemistry.

Formula: C₉D₁₂

InChI: InChI=1S/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3/i1D3,2D3,3D3,4D,5D,6D

InChI key: GWHJZXXIDMPWGX-ZPMNDIOMSA-N

SMILES: [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H]

Synonyms:

• 1,2,4-Trimethylbenzene-D12

1,2,4-Trimethylbenzene-d12

CAS: 350818-61-0, 95-63-6

Formula: (CD₃)₃C₆D₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 132.16922

Ref: 3U-D5062

1,2,4-Trimethylbenzene-d12

Controlled Product

CAS: 350818-61-0

Applications 1,2,4-Trimethylbenzene-d12 (CAS# 350818-61-0) is a useful isotopically labeled research compound.

Formula: C₉D₁₂

Color and Shape: Neat

Molecular weight: 132.27

Ref: TR-T796177