CAS 351227-42-4

6-chloro-4-iodopyridin-3-amine

Description:

6-Chloro-4-iodopyridin-3-amine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of chlorine and iodine substituents at the 6 and 4 positions, respectively, contributes to its unique reactivity and potential applications in medicinal chemistry and material science. The amino group at the 3-position enhances its nucleophilicity, making it a valuable intermediate in various chemical syntheses. This compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the presence of halogens can influence the compound's electronic properties, stability, and reactivity, which are crucial for its application in synthetic pathways. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-chloro-4-iodopyridin-3-amine is a versatile compound with significant implications in both research and industrial applications.

Formula: C₅H₄ClIN₂

InChI: InChI=1/C5H4ClIN2/c6-5-1-3(7)4(8)2-9-5/h1-2H,8H2

SMILES: c1c(c(cnc1Cl)N)I

Synonyms:

• 3-Pyridinamine, 6-Chloro-4-Iodo-
• 6-Chloro-4-iodopyridin-3-amine

6-Chloro-4-iodopyridin-3-amine

CAS: 351227-42-4

Formula: C₅H₄ClIN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.4561

Ref: IN-DA00C0QG

6-Chloro-4-iodopyridin-3-amine

CAS: 351227-42-4

6-Chloro-4-iodopyridin-3-amine

Formula: C₅H₄ClIN₂

Purity: 97%

Color and Shape: white to off-white crystalline needles

Molecular weight: 254.46g/mol

Ref: 54-OR960084

6-Chloro-4-iodopyridin-3-amine

CAS: 351227-42-4

Formula: C₅H₄ClIN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.46

Ref: 10-F225330