CymitQuimica logo

CAS 351227-42-4

:

6-chloro-4-iodopyridin-3-amine

Description:
6-Chloro-4-iodopyridin-3-amine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of chlorine and iodine substituents at the 6 and 4 positions, respectively, contributes to its unique reactivity and potential applications in medicinal chemistry and material science. The amino group at the 3-position enhances its nucleophilicity, making it a valuable intermediate in various chemical syntheses. This compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the presence of halogens can influence the compound's electronic properties, stability, and reactivity, which are crucial for its application in synthetic pathways. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-chloro-4-iodopyridin-3-amine is a versatile compound with significant implications in both research and industrial applications.
Formula:C5H4ClIN2
InChI:InChI=1/C5H4ClIN2/c6-5-1-3(7)4(8)2-9-5/h1-2H,8H2
InChI key:UOICMMKVFPTQMX-UHFFFAOYSA-N
SMILES:c1c(c(cnc1Cl)N)I
Synonyms:
  • 3-Pyridinamine, 6-Chloro-4-Iodo-
  • 6-Chloro-4-iodopyridin-3-amine
Found 4 products.