CymitQuimica logo

CAS 351410-37-2

:

3-Pyridineacetonitrile,2-methoxy-

Description:
3-Pyridineacetonitrile, 2-methoxy- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a nitrile group (-C≡N) attached to the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of a methoxy group (-OCH₃) at the 2-position of the pyridine ring enhances its solubility in organic solvents and may influence its electronic properties. Typically, compounds like this are of interest in medicinal chemistry and material science due to their ability to act as intermediates in the synthesis of pharmaceuticals or agrochemicals. The compound's physical properties, such as boiling point, melting point, and solubility, are influenced by its functional groups and molecular structure. Additionally, safety data sheets should be consulted for handling and storage guidelines, as compounds with nitrile groups can pose health risks if not managed properly. Overall, 3-Pyridineacetonitrile, 2-methoxy- is a versatile compound with potential applications in various chemical fields.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-11-8-7(4-5-9)3-2-6-10-8/h2-3,6H,4H2,1H3
InChI key:XYGNRNRLVJUPEB-UHFFFAOYSA-N
SMILES:COC1=C(C=CC=N1)CC#N
Synonyms:
  • 3-Pyridineacetonitrile,2-methoxy-(9CI)
Found 3 products.