CymitQuimica logo

CAS 35161-14-9

:

2-Cyclohexen-1-one, 4,4-diethyl-

Description:
2-Cyclohexen-1-one, 4,4-diethyl- is an organic compound characterized by its cyclohexene ring structure with a ketone functional group. It features two ethyl groups attached to the fourth carbon of the cyclohexene ring, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as nucleophilic additions and cycloadditions. The presence of the double bond in the cyclohexene ring makes it susceptible to electrophilic attack, while the ketone group can engage in condensation reactions. Additionally, 2-Cyclohexen-1-one, 4,4-diethyl- may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with similar structures. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C10H16O
InChI:InChI=1S/C10H16O/c1-3-10(4-2)7-5-9(11)6-8-10/h5,7H,3-4,6,8H2,1-2H3
InChI key:ZMNPBXGWZOROKH-UHFFFAOYSA-N
SMILES:CCC1(CCC(=O)C=C1)CC
Found 4 products.