CAS 3519-82-2
:9,10-Dihydro-9,10[1′,2′]-benzenoanthracene-1,4-dione
Description:
9,10-Dihydro-9,10[1′,2′]-benzenoanthracene-1,4-dione, with CAS number 3519-82-2, is an organic compound that belongs to the class of polycyclic aromatic compounds. It features a fused ring system that incorporates both anthracene and a benzenoid structure, contributing to its unique chemical properties. This compound is characterized by its diketone functional groups, which can participate in various chemical reactions, including reduction and oxidation. It typically exhibits a solid state at room temperature and may have a characteristic color, often associated with its conjugated system. The presence of multiple aromatic rings allows for significant π-π stacking interactions, influencing its solubility and stability in different solvents. Additionally, due to its structural features, it may exhibit interesting electronic properties, making it a subject of interest in materials science and organic electronics. Its reactivity and potential applications in organic synthesis and as a precursor for other chemical entities are also noteworthy. However, handling and usage should be approached with caution due to potential toxicity associated with polycyclic aromatic compounds.
Formula:C20H12O2
InChI:InChI=1S/C20H12O2/c21-15-9-10-16(22)20-18-12-6-2-1-5-11(12)17(19(15)20)13-7-3-4-8-14(13)18/h1-10,17-18H
InChI key:InChIKey=GCHPUOHXXCNSQL-UHFFFAOYSA-N
SMILES:O=C1C=2C3C=4C(C(C2C(=O)C=C1)C=5C3=CC=CC5)=CC=CC4
Synonyms:- 1,4-Triptycenoquinone
- 12,15-Dihydro-12,15-dioxotriptycene
- 9,10-Dihydro-9,10-[1′,2′]benzenoanthracene-1,4-dione
- 9,10-Dihydro-9,10-o-benzenoanthracene-1,4-dione
- 9,10-[1,2]-Benzenoanthracene-13,16(9H,10H)-dione
- 9,10-o-Benzenoanthracene-1,4-dione, 9,10-dihydro-
- 9,10[1′,2′]-Benzenoanthracene-1,4-dione, 9,10-dihydro-
- Inca 6
- NSC 25996
- Pentacyclo[6.6.6.0~2,7~.0~9,14~.0~15,20~]icosa-2(7),4,9,11,13,15,17,19-octaene-3,6-dione
- Triptycene-1,4-quinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
INCA-6
CAS:INCA-6 (Triptycene-1,4-quinone) is a cell-permeable NFAT inhibitor.
Formula:C20H12O2Purity:99.82% - 99.88%Color and Shape:SolidMolecular weight:284.31NFAT Activation Inhibitor III
CAS:NFAT Activation Inhibitor III is a chemical inhibitor that prevents the activation of NFAT. NFATs are transcription factors that regulate the expression of genes in cells. The activation of NFATs is triggered by Ca2+ signals and growth factors, which are important for cardiac hypertrophy. This inhibitor has been shown to prevent the development of cardiac hypertrophy and heart failure in vivo and in vitro models. It also inhibits the production of pro-inflammatory cytokines, such as IL-1β, IL-6, and TNFα. NFAT Activation Inhibitor III may also be used to treat inflammation or neurodegenerative diseases, such as Alzheimer's disease or Parkinson's disease.Formula:C20H12O2Purity:Min. 95%Molecular weight:284.31 g/mol


