CymitQuimica logo

CAS 35203-49-7

:

N~1~-methyl-4-(trifluoromethyl)benzene-1,2-diamine

Description:
N~1~-methyl-4-(trifluoromethyl)benzene-1,2-diamine, also known by its CAS number 35203-49-7, is an organic compound characterized by the presence of a methyl group and a trifluoromethyl group attached to a benzene ring that also contains two amino groups at the 1 and 2 positions. This compound exhibits properties typical of aromatic amines, including potential reactivity due to the amino groups, which can participate in various chemical reactions such as nucleophilic substitutions. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its electronic properties, making it useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms often enhances the stability and bioactivity of organic molecules. Safety considerations are important when handling this compound, as many aromatic amines can be hazardous and may pose health risks. Overall, N~1~-methyl-4-(trifluoromethyl)benzene-1,2-diamine is a compound of interest in both research and industrial contexts due to its unique structural features and potential applications.
Formula:C8H9F3N2
InChI:InChI=1/C8H9F3N2/c1-13-7-3-2-5(4-6(7)12)8(9,10)11/h2-4,13H,12H2,1H3
InChI key:KWYSQBACVABOFL-UHFFFAOYSA-N
SMILES:CNc1ccc(cc1N)C(F)(F)F
Synonyms:
  • 1,2-benzenediamine, N~1~-methyl-4-(trifluoromethyl)-
  • N-[2-amino-4-(trifluoromethyl)phenyl]-N-methylamine
Found 4 products.