CAS 352535-83-2
:5-Chloro-2-fluorobenzeneboronic acid
Description:
5-Chloro-2-fluorobenzeneboronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and halogen substituents on a benzene ring. This compound features a chlorine atom at the 5-position and a fluorine atom at the 2-position of the aromatic ring, which influences its reactivity and solubility. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The presence of halogens can enhance the compound's electrophilicity and may facilitate cross-coupling reactions, such as Suzuki-Miyaura coupling, which is widely used in the formation of carbon-carbon bonds. Additionally, the compound's solubility in polar solvents and its stability under standard laboratory conditions make it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Overall, 5-Chloro-2-fluorobenzeneboronic acid is a versatile building block in organic chemistry with significant implications in research and industry.
Formula:C6H5BClFO2
InChI:InChI=1/C6H5BClFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H
SMILES:c1cc(c(cc1Cl)B(O)O)F
Synonyms:- (5-Chloro-2-fluorophenyl)boronic acid
- 5-Chloro-2-fluorophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chloro-2-fluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H5BClFO2Purity:97.0 to 112.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:174.365-Chloro-2-fluorobenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H5BClFO2Purity:97%Molecular weight:174.375-Chloro-2-fluorobenzeneboronic acid
CAS:5-Chloro-2-fluorobenzeneboronic acidFormula:C6H5BClFO2Purity:97%Color and Shape:Solid-PowderMolecular weight:174.36515-Chloro-2-fluorophenylboronic acid
CAS:Formula:C6H5BClFO2Purity:97%Color and Shape:SolidMolecular weight:174.36515-Chloro-2-fluorobenzeneboronic acid
CAS:Formula:C6H5BClFO2Purity:97%Color and Shape:SolidMolecular weight:174.36




