CAS 35263-73-1: (gly-oh10)-luteinizing hormone*releasing hormone
Description:Glycyl-Luteinizing Hormone-Releasing Hormone (often abbreviated as Gly-LHRH) is a synthetic peptide that plays a crucial role in the regulation of reproductive hormones. It is a decapeptide, meaning it consists of ten amino acids, and is a derivative of the naturally occurring Luteinizing Hormone-Releasing Hormone (LHRH). The primary function of Gly-LHRH is to stimulate the release of luteinizing hormone (LH) and follicle-stimulating hormone (FSH) from the anterior pituitary gland, which are essential for reproductive processes in both males and females. The modification of the peptide structure, such as the addition of a glycine residue, can enhance its stability and bioactivity compared to its natural counterpart. Gly-LHRH is utilized in various biomedical applications, including research on reproductive health and potential therapeutic interventions for hormone-related disorders. Its CAS number, 35263-73-1, is a unique identifier that facilitates the cataloging and identification of this specific chemical substance in scientific literature and databases.
Formula:C55H74N16O14
InChI:InChI=1/C55H74N16O14/c1-29(2)19-38(49(80)66-37(9-5-17-59-55(56)57)54(85)71-18-6-10-43(71)53(84)62-26-46(76)77)65-45(75)25-61-47(78)39(20-30-11-13-33(73)14-12-30)67-52(83)42(27-72)70-50(81)40(21-31-23-60-35-8-4-3-7-34(31)35)68-51(82)41(22-32-24-58-28-63-32)69-48(79)36-15-16-44(74)64-36/h3-4,7-8,11-14,23-24,28-29,36-43,60,72-73H,5-6,9-10,15-22,25-27H2,1-2H3,(H,58,63)(H,61,78)(H,62,84)(H,64,74)(H,65,75)(H,66,80)(H,67,83)(H,68,82)(H,69,79)(H,70,81)(H,76,77)(H4,56,57,59)/t36-,37-,38-,39-,40-,41-,42-,43-/m0/s1
- Synonyms:
- LHRH (free acid)
- Pyr-His-Trp-Ser-Tyr-Gly-Leu-Arg-Pro-Gly-OH
- 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosylglycyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-L-prolylglycine