CymitQuimica logo

CAS 35264-07-4

:

boc-L-alloisoleucine

Description:
Boc-L-alloisoleucine, with the CAS number 35264-07-4, is a derivative of the amino acid isoleucine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group on the amino group. This compound is typically used in peptide synthesis and research due to its ability to protect the amino group during chemical reactions, allowing for selective modifications of other functional groups. Boc-L-alloisoleucine is a non-polar, hydrophobic amino acid, which influences the folding and stability of peptides and proteins in which it is incorporated. Its structure includes a branched side chain, which contributes to its unique properties compared to other amino acids. The Boc group can be removed under acidic conditions, facilitating the formation of peptides with desired sequences. As with many amino acid derivatives, Boc-L-alloisoleucine is utilized in various biochemical applications, including drug development and the study of protein interactions. Proper handling and storage conditions are essential to maintain its stability and reactivity in laboratory settings.
Formula:C11H21NO4
InChI:InChI=1S/C11H21NO4/c1-6-7(2)8(9(13)14)12-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14)/t7-,8+/m1/s1
InChI key:QJCNLJWUIOIMMF-SFYZADRCSA-N
SMILES:CC[C@@H](C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C
Synonyms:
  • Boc-allo-Ile-OH
Found 7 products.