CAS 35400-60-3

3-(3-hydroxy-4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one

Description:

3-(3-hydroxy-4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one, with the CAS number 35400-60-3, is a synthetic organic compound characterized by its complex structure featuring multiple hydroxyl and methoxy functional groups. This compound belongs to the class of flavonoids or polyphenols, which are known for their antioxidant properties. The presence of hydroxyl groups contributes to its potential biological activities, including anti-inflammatory and anticancer effects. The methoxy group enhances its lipophilicity, potentially influencing its solubility and bioavailability. Typically, compounds like this are studied for their pharmacological properties, including their ability to scavenge free radicals and modulate various biochemical pathways. Additionally, the structural features suggest that it may interact with various biological targets, making it of interest in medicinal chemistry and natural product research. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other chemical species.

Formula: C₁₆H₁₆O₆

InChI: InChI=1/C16H16O6/c1-22-15-5-3-9(6-12(15)19)2-4-11(18)16-13(20)7-10(17)8-14(16)21/h3,5-8,17,19-21H,2,4H2,1H3

SMILES: COc1ccc(CCC(=O)c2c(cc(cc2O)O)O)cc1O

Synonyms:

• 1-Propanone, 3-(3-Hydroxy-4-Methoxyphenyl)-1-(2,4,6-Trihydroxyphenyl)-
• 3-(3-Hydroxy-4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone

Hesperetin dihydrochalcone

CAS: 35400-60-3

Hesperetin dihydrochalcone analytical standard provided with w/w absolute assay, to be used for quantitative titration.

Formula: C₁₆H₁₆O₆

Purity: (HPLC) ≥98%

Color and Shape: Powder

Molecular weight: 304.3

Ref: 11-1381S

3-(3-Hydroxy-4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one

CAS: 35400-60-3

3-(3-Hydroxy-4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one

Purity: 95%

Molecular weight: 304.3g/mol

Ref: 54-OR1070350

Hesperitin dihydrochalcone

CAS: 35400-60-3

Formula: C₁₆H₁₆O₆

Purity: 95%~99%

Molecular weight: 304.298

Ref: BP-BP5384

4-Methoxy-2',4',6',3-tetrahydroxydihydrochalcone

CAS: 35400-60-3

4-Methoxy-2',4',6',3-tetrahydroxydihydrochalcone is a dihydrochalcone, which is a type of polyphenolic compound. It is derived from plant sources, commonly found in certain fruits and flowers. This compound exhibits antioxidant properties by scavenging free radicals, thereby reducing oxidative stress within biological systems. The efficacy of its mode of action is attributed to its molecular structure, enabling it to donate hydrogen atoms and stabilize radical species.

Formula: C₁₆H₁₆O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 304.29 g/mol

Ref: 3D-FM66072