CAS 355-46-4: Perfluorohexanesulfonic acid
Description:Perfluorohexanesulfonic acid (PFHxS) is a synthetic perfluoroalkyl substance (PFAS) characterized by a long carbon chain with six carbon atoms fully fluorinated, attached to a sulfonic acid functional group. This compound is known for its remarkable chemical stability and resistance to degradation, which is a hallmark of PFAS. PFHxS exhibits high surface activity, making it effective in applications such as surfactants and stain repellents. Its hydrophobic and lipophobic properties contribute to its use in various industrial processes, including firefighting foams and coatings. However, PFHxS is also associated with environmental persistence and bioaccumulation, raising concerns regarding its potential health effects, including endocrine disruption and developmental toxicity. Regulatory scrutiny has increased due to its presence in water sources and wildlife, leading to efforts aimed at reducing its use and exposure. Overall, while PFHxS has useful industrial applications, its environmental and health implications necessitate careful management and ongoing research.
Formula:C6HF13O3S
InChI:InChI=1S/C6HF13O3S/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22/h(H,20,21,22)
InChI key:InChIKey=QZHDEAJFRJCDMF-UHFFFAOYSA-N
SMILES:O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluoro-1-hexanesulfonic acid
- 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexane-1-sulfonic acid
- 1-Hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-
- 1-Hexanesulfonic acid, tridecafluoro-
- 1-Perfluorohexanesulfonic acid
- PFHxS
- Perfluorohexanesulfonic acid
- Tridecafluorohexan-1-sulfonic acid
- Tridecafluorohexanesulfonic acid
- Perfluorohexane-1-sulphonic acid
- See more synonyms
