CAS 3551-55-1
:2,4-Dimethoxypyrimidine
Description:
2,4-Dimethoxypyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two methoxy groups at the 2 and 4 positions. Its molecular formula is C7H9N3O2, and it features a nitrogen-containing six-membered ring, which is a common structural motif in various biological and pharmaceutical compounds. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and has a relatively low melting point. 2,4-Dimethoxypyrimidine is of interest in medicinal chemistry and may serve as a building block for the synthesis of more complex molecules. Its derivatives can exhibit various biological activities, making it a subject of research in drug development. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C6H8N2O2
InChI:InChI=1/C6H8N2O2/c1-9-5-3-4-7-6(8-5)10-2/h3-4H,1-2H3
SMILES:COc1ccnc(n1)OC
Synonyms:- 2,4-Dimethoxyprimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,4-Dimethoxypyrimidine
CAS:Formula:C6H8N2O2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:140.142,4-Dimethoxypyrimidine, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H8N2O2Purity:98+%Color and Shape:Clear colorless, LiquidMolecular weight:140.14Pyrimidine, 2,4-dimethoxy-
CAS:Formula:C6H8N2O2Purity:98%Color and Shape:LiquidMolecular weight:140.13992,4-Dimethoxypyrimidine
CAS:2,4-DimethoxypyrimidineFormula:C6H8N2O2Purity:98%Molecular weight:140.139912,4-Dimethoxypyrimidine
CAS:Controlled ProductApplications 2,4-Dimethoxypyrimidine, is a versatile building block used in synthesis of various chemical compounds, such as derivatives of Cytidine (C998300).
References Kammerer, B., et al.: Anal. Biol. Chem., 382, 1017 (2005); Strong, L. and Matsunaga, H.: J. Surg. Oncol., 4, 528 (1972)Formula:C6H8N2O2Color and Shape:NeatMolecular weight:140.14







