CAS 35564-86-4
:Meglumine hydrochloride
Description:
Meglumine hydrochloride is a chemical compound that serves primarily as a pharmaceutical excipient and is often used in the formulation of various medications. It is a white to off-white crystalline powder that is hygroscopic, meaning it can absorb moisture from the environment. The compound is soluble in water, which facilitates its use in injectable formulations and other aqueous solutions. Meglumine hydrochloride is derived from meglumine, a sugar alcohol, and is characterized by its ability to enhance the solubility of certain drugs, making it valuable in the pharmaceutical industry. It is generally recognized as safe when used in appropriate amounts, but like any chemical substance, it may have specific safety and handling considerations. The compound is often utilized in imaging agents for medical diagnostics, particularly in radiology, due to its properties that improve the contrast of images. Overall, meglumine hydrochloride plays a significant role in enhancing drug delivery and efficacy in various therapeutic applications.
Formula:C7H17NO5·ClH
InChI:InChI=1S/C7H17NO5.ClH/c1-8-2-4(10)6(12)7(13)5(11)3-9;/h4-13H,2-3H2,1H3;1H/t4-,5+,6+,7+;/m0./s1
InChI key:InChIKey=PKPZZAVJXDZHDW-LJTMIZJLSA-N
SMILES:[C@H]([C@@H]([C@@H](CO)O)O)([C@H](CNC)O)O.Cl
Synonyms:- <span class="text-smallcaps">D</span>-(-)-N-Methylglucaminium chloride
- <span class="text-smallcaps">D</span>-Glucitol, 1-deoxy-1-(methylamino)-, hydrochloride
- <span class="text-smallcaps">D</span>-Glucitol, 1-deoxy-1-(methylamino)-, hydrochloride (1:1)
- Meglumine hydrochloride
- Methylglucamine chloride
- N-Methyl-<span class="text-smallcaps">D</span>-glucamine hydrochloride
- N-Methyl-D-glucamine hydrochloride
- N-Methylglucamine hydrochloride
- D-Glucitol, 1-deoxy-1-(methylamino)-, hydrochloride
- D-Glucitol, 1-deoxy-1-(methylamino)-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N-Methyl-d-glucamine HCl
CAS:Formula:C7H18ClNO5Purity:97%Color and Shape:SolidMolecular weight:231.6745N-Methyl-D-Glucamine Hydrochloride
CAS:N-Methyl-D-Glucamine HydrochlorideFormula:C7H18ClNO5Purity:97%Molecular weight:231.67N-Methyl-D-glucamine Hydrochloride [for Buffer]
CAS:Formula:C7H17NO5·HClPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:231.67N-Methyl-D-glucamine hydrochloride
CAS:Formula:C7H17NO5·HClPurity:(HPLC) ≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:231.67N-Methyl-D-glucamine HCl
CAS:N-Methyl-D-glucamine HCl is a salt of N-methylglucamine and hydrochloric acid. It is used as a buffer to maintain the pH of solutions at a desired level. N-Methyl-D-glucamine HCl has an inhibition constant (Ki) of 0.5 mM for glutamate, which can be used to measure the concentration of glutamate in tissue samples or reaction mixtures. This compound also inhibits locomotor activity, and its effect on blood pressure may be due to its ability to inhibit amines. The Ki for chloride is approximately 2 mM, and it can be used to measure the concentration of chloride in solution.Formula:C7H17NO5·HClColor and Shape:PowderMolecular weight:231.67 g/molN-Methyl-d-glucamine hydrochloride
CAS:Formula:C7H18ClNO5Purity:97%Color and Shape:SolidMolecular weight:231.67






