CymitQuimica logo

CAS 356-36-5

:

dimethyl tetrafluorosuccinate

Description:
Dimethyl tetrafluorosuccinate, with the CAS number 356-36-5, is an organic compound characterized by its structure, which includes two methyl ester groups and four fluorine atoms attached to a succinate backbone. This compound is a colorless liquid at room temperature and is known for its high volatility and low viscosity. The presence of fluorine atoms imparts unique properties, such as increased electronegativity and stability, making it less reactive compared to its non-fluorinated counterparts. Dimethyl tetrafluorosuccinate is often used in various applications, including as a solvent, reagent, or intermediate in organic synthesis. Its fluorinated nature can enhance its performance in specific chemical reactions and applications, particularly in the fields of pharmaceuticals and agrochemicals. However, handling this compound requires caution due to potential toxicity and environmental concerns associated with fluorinated compounds. Proper safety measures should be observed when working with dimethyl tetrafluorosuccinate to mitigate any health risks.
Formula:C6H6F4O4
InChI:InChI=1/C6H6F4O4/c1-13-3(11)5(7,8)6(9,10)4(12)14-2/h1-2H3
InChI key:RMXAYQBUNVSEPG-UHFFFAOYSA-N
SMILES:COC(=O)C(C(C(=O)OC)(F)F)(F)F
Synonyms:
  • Dimethyl Tetrafluorobutanedioate
Found 4 products.