CymitQuimica logo

CAS 356072-46-3

:

spiro[indole-3,4'-piperidin]-2(1H)-one hydrochloride (1:1)

Description:
Spiro[indole-3,4'-piperidin]-2(1H)-one hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which combines an indole moiety with a piperidine ring. This compound typically exhibits properties associated with both indole and piperidine derivatives, including potential biological activity. The presence of the hydrochloride salt form suggests enhanced solubility in aqueous environments, which is beneficial for pharmacological applications. The spiro configuration contributes to its three-dimensional structure, potentially influencing its interaction with biological targets. This compound may be of interest in medicinal chemistry for its potential therapeutic effects, particularly in areas such as neuropharmacology or as a scaffold for drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise molecular interactions and the environment in which it is studied. As with many compounds, safety and handling precautions should be observed due to its chemical nature.
Formula:C12H15ClN2O
InChI:InChI=1/C12H14N2O.ClH/c15-11-12(5-7-13-8-6-12)9-3-1-2-4-10(9)14-11;/h1-4,13H,5-8H2,(H,14,15);1H
InChI key:MYFMLWOZVQXZNY-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)C1(CCNCC1)C(=N2)O.Cl
Synonyms:
  • Spiro[indole-3,4'-piperidin]-2(1H)-one hydrochloride (1:1)
Found 5 products.