CymitQuimica logo

CAS 35694-08-7

:

Pcb 194

Description:
PCB 194, or polychlorinated biphenyl 194, is a member of the polychlorinated biphenyl (PCB) family, which consists of synthetic organic chemicals with varying degrees of chlorination. PCB 194 is characterized by its complex structure, containing multiple chlorine atoms attached to biphenyl, which affects its physical and chemical properties. It is typically a viscous, oily liquid at room temperature and is insoluble in water but soluble in organic solvents. PCBs, including PCB 194, are known for their stability, resistance to degradation, and hydrophobic nature, which contribute to their persistence in the environment. They have been used in various industrial applications, such as electrical equipment, heat transfer fluids, and as additives in paints and sealants. However, due to their toxicity and potential to bioaccumulate in the food chain, PCBs have been largely banned or restricted in many countries. PCB 194, like other PCBs, poses environmental and health risks, including potential endocrine disruption and carcinogenic effects, necessitating careful handling and disposal.
Formula:C12H2Cl8
InChI:InChI=1S/C12H2Cl8/c13-5-1-3(7(15)11(19)9(5)17)4-2-6(14)10(18)12(20)8(4)16/h1-2H
InChI key:InChIKey=DTMRKGRREZAYAP-UHFFFAOYSA-N
SMILES:ClC1=C(C=C(Cl)C(Cl)=C1Cl)C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 12 products.