CAS 35730-78-0: Cynaropicrin
Description:Cynaropicrin is a natural compound classified as a sesquiterpene lactone, primarily found in artichokes (Cynara scolymus) and other members of the Asteraceae family. It is known for its bitter taste and is often associated with the plant's medicinal properties. The chemical structure of cynaropicrin features a lactone ring, contributing to its biological activity. This compound exhibits various pharmacological effects, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in both food science and medicinal research. Additionally, cynaropicrin has been studied for its role in stimulating appetite and aiding digestion, which aligns with traditional uses of artichokes. Its CAS number, 35730-78-0, is a unique identifier that facilitates the cataloging and study of this compound in scientific literature. Overall, cynaropicrin represents a significant example of how natural products can influence health and nutrition.
Formula:C19H22O6
InChI:InChI=1S/C19H22O6/c1-8-5-14(24-18(22)9(2)7-20)16-11(4)19(23)25-17(16)15-10(3)13(21)6-12(8)15/h12-17,20-21H,1-7H2/t12-,13-,14-,15-,16+,17+/m0/s1
InChI key:InChIKey=KHSCYOFDKADJDJ-NQLMQOPMSA-N
SMILES:O=C(OC1CC(=C)C2CC(O)C(=C)C2C3OC(=O)C(=C)C13)C(=C)CO
- Synonyms:
- 2-(Hydroxymethyl)-2-propenoic Acid (3aR,4S,6aR,8S,9aR,9bR)-Dodecahydro-8-hydroxy-3,6,9-tris(methylene)-2-oxoazuleno[4,5-b]furan-4-yl Ester
- 2-Propenoic acid, 2-(hydroxymethyl)-, (3aR,4S,6aR,8S,9aR,9bR)-dodecahydro-8-hydroxy-3,6,9-tris(methylene)-2-oxoazuleno(4,5-b)furan-4-yl ester
- 2-Propenoic acid, 2-(hydroxymethyl)-, dodecahydro-8-hydroxy-3,6,9-tris(methylene)-2-oxoazuleno[4,5-b]furan-4-yl ester, [3aR-(3aα,4α,6aα,8β,9aα,9bβ)]-
- 68370-45-6
- Azuleno[4,5-b]furan, 2-propenoic acid deriv.
- Cynaropicrin
- Cynaropikrin
