CAS 3577-87-5
:Methyl diphenylphosphite
Description:
Methyl diphenylphosphite is an organophosphorus compound characterized by its phosphite functional group, where a phosphorus atom is bonded to two phenyl groups and one methyl group. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is known for its role as a reagent in organic synthesis and as a stabilizer in various applications, particularly in the production of polymers and plastics. Methyl diphenylphosphite exhibits moderate solubility in organic solvents, while being relatively insoluble in water. It is important to handle this substance with care, as it may pose health risks upon exposure, including potential irritation to the skin, eyes, and respiratory system. Additionally, it is classified as a hazardous material, necessitating appropriate safety measures during storage and use. Its chemical stability and reactivity make it valuable in various industrial processes, particularly in the synthesis of phosphonates and other phosphorus-containing compounds.
Formula:C13H13O3P
InChI:InChI=1/C13H13O3P/c1-14-17(15-12-8-4-2-5-9-12)16-13-10-6-3-7-11-13/h2-11H,1H3
SMILES:COP(Oc1ccccc1)Oc1ccccc1
Synonyms:- Phosphorous acid, methyl diphenyl ester
- Methyl Diphenyl Phosphite
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
