CymitQuimica logo

CAS 35808-40-3

:

1,2,3,4-tetrahydropyrido[2,3-b]pyrazine

Description:
1,2,3,4-Tetrahydropyrido[2,3-b]pyrazine is a bicyclic organic compound characterized by its fused pyridine and pyrazine rings. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It has a molecular formula that reflects its complex structure, contributing to its unique chemical properties. The compound is known for its potential biological activity, which may include effects on the central nervous system or other physiological processes, making it of interest in medicinal chemistry. Its solubility can vary, often being more soluble in organic solvents than in water. The presence of nitrogen atoms in its structure can influence its reactivity and interactions with other chemical species. Additionally, 1,2,3,4-tetrahydropyrido[2,3-b]pyrazine may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and analysis. Overall, this compound represents a fascinating area of study within heterocyclic chemistry and its applications in pharmaceuticals.
Formula:C7H9N3
InChI:InChI=1/C7H9N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-3,8H,4-5H2,(H,9,10)
InChI key:HOFCYSNYAFJTSI-UHFFFAOYSA-N
SMILES:c1cc2c(nc1)NCCN2
Synonyms:
  • Pyrido[2,3-B]Pyrazine, 1,2,3,4-Tetrahydro-
  • 1,2,3,4-Tetrahydropyrido[2,3-b]pyrazine
Found 4 products.