CymitQuimica logo

CAS 35817-27-7

:

4-Ethoxycoumarin

Description:
4-Ethoxycoumarin is a synthetic organic compound belonging to the coumarin family, characterized by its ethoxy group at the 4-position of the coumarin ring. It typically appears as a pale yellow to white crystalline solid and is known for its fluorescent properties, making it useful in various applications, including as a fluorescent probe in biochemical assays. The compound has a molecular formula that reflects its structure, which includes a coumarin backbone and an ethoxy substituent. 4-Ethoxycoumarin is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. Its fluorescence can be influenced by the pH of the environment, which is a valuable property for studying biological systems. Additionally, it has been investigated for its potential applications in drug development and as a tool in molecular biology due to its ability to undergo photochemical reactions. Safety data indicates that, like many organic compounds, it should be handled with care, following appropriate safety protocols to minimize exposure.
Formula:C11H10O3
InChI:InChI=1/C11H10O3/c1-2-13-10-7-11(12)14-9-6-4-3-5-8(9)10/h3-7H,2H2,1H3
InChI key:FLZDKBHAUILYAZ-UHFFFAOYSA-N
SMILES:CCOc1cc(=O)oc2ccccc12
Synonyms:
  • 4-ethoxy-2H-chromen-2-one
Found 7 products.