CAS 3585-52-2
:Benzeneacetic acid,4-ethyl-a-methyl-
Description:
Benzeneacetic acid, 4-ethyl-α-methyl- (CAS 3585-52-2) is an aromatic carboxylic acid characterized by its benzene ring structure substituted with an ethyl group and a methyl group at the alpha position relative to the carboxylic acid functional group. This compound typically exhibits a white to light yellow crystalline appearance and is soluble in organic solvents, while having limited solubility in water due to its hydrophobic aromatic structure. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its molecular structure contributes to its potential applications in organic synthesis, pharmaceuticals, and as an intermediate in the production of other chemical compounds. Additionally, the presence of the ethyl and methyl substituents can influence its reactivity and interaction with biological systems, making it of interest in medicinal chemistry and research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-3-9-4-6-10(7-5-9)8(2)11(12)13/h4-8H,3H2,1-2H3,(H,12,13)
InChI key:VGMCZELQCNPMQV-UHFFFAOYSA-N
SMILES:CCC1=CC=C(C=C1)C(C)C(=O)O
Synonyms:- Hydratropicacid, p-ethyl- (7CI,8CI)
- 2-(4-Ethylphenyl)propionic acid
- 2-(p-Ethylphenyl)propionic acid
- p-Ethylhydratropic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
IBUPROFEN FOR PEAK IDENTIFICATION CRS
CAS:IBUPROFEN FOR PEAK IDENTIFICATION CRSFormula:C13H18O2Molecular weight:206.2808Ibuprofen EP Impurity N
CAS:Formula:C11H14O2Color and Shape:Pale Yellow Semi-Solid (Low M P )Molecular weight:178.232-(4-Ethylphenyl)propanoic acid
CAS:Formula:C11H14O2Purity:95%Color and Shape:SolidMolecular weight:178.2277(2RS)-2-(4-Ethylphenyl)propanoic Acid
CAS:Formula:C11H14O2Color and Shape:NeatMolecular weight:178.23p-Ethylhydratropic Acid
CAS:Impurity Ibuprofen EP Impurity N
Applications p-Ethylhydratropic Acid (Ibuprofen EP Impurity N) is a phenylacetic acid with potential antiinflammatory activities. p-Ethylhydratropic Acid is an impurity of Ibuprofen (I140000).Formula:C11H14O2Color and Shape:NeatMolecular weight:178.232-(4-Ethylphenyl)-propanoic acid - Racemic
CAS:2-(4-Ethylphenyl)-propanoic acid is a supplement that is used to relieve pain and inflammation. It belongs to the group of non-steroidal anti-inflammatory drugs (NSAIDs). This drug has been shown to be efficacious in the treatment of osteoarthritis, rheumatoid arthritis, and bronchitis. 2-(4-Ethylphenyl)-propanoic acid inhibits both prostaglandin synthesis and leukotriene synthesis by inhibiting cyclooxygenase 1, which converts arachidonic acid into prostaglandins, and 5-lipoxygenase, which converts arachidonic acid into leukotrienes. This drug has also been shown to inhibit COX-2 production in human monocytes. The active form of this drug is metabolized through a number of metabolic transformations including hydrolysis by esterases or glucuronidases, oxidation by cytochrome P450 enzymes,Formula:C11H14O2Purity:Min. 95%Molecular weight:178.23 g/mol









