CAS 358730-83-3

Ethanone-2,2,2-d3,1-[4-(methyl-d3)phenyl-2,3,5,6-d4]- (9CI)

Description:

Ethanone-2,2,2-d3,1-[4-(methyl-d3)phenyl-2,3,5,6-d4]- (9CI), with the CAS number 358730-83-3, is a deuterated compound used primarily in research and analytical chemistry. Its structure features a ketone functional group, specifically ethanone, which is substituted with deuterium isotopes at specific positions, enhancing its utility in studies involving nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. The presence of deuterium, a stable isotope of hydrogen, allows for improved resolution and sensitivity in analytical techniques. The compound also contains a phenyl group substituted with a methyl group, which is also deuterated, indicating that it may be used in studies related to aromatic chemistry or in the investigation of reaction mechanisms. The isotopic labeling can help trace the pathways of chemical reactions or the behavior of molecules in biological systems. Overall, this compound is valuable in the field of isotopic labeling and can provide insights into molecular dynamics and interactions in various chemical contexts.

Formula: C₉D₁₀O

InChI: InChI=1S/C9H10O/c1-7-3-5-9(6-4-7)8(2)10/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D

InChI key: GNKZMNRKLCTJAY-ZGYYUIRESA-N

SMILES: [2H]C1=C(C(=C(C(=C1C(=O)C([2H])([2H])[2H])[2H])[2H])C([2H])([2H])[2H])[2H]

Synonyms:

• 4’-Methylacetophenone-D10

4'-Methylacetophenone-D10

CAS: 358730-83-3

4'-Methylacetophenone-D10 is the deuterium labeled 4'-Methylacetophenone (T19137). 4'-Methylacetophenone can be used as a fragrance material. It is wildly occurred in volatile compounds in food and in some natural complex substances.

Formula: C₉H₁₀O

Molecular weight: 144.24

Ref: TM-TMIR-0159

4'-Methylacetophenone-d10

CAS: 122-00-9, 358730-83-3

Purity: 98 atom % D

Color and Shape: Colorless. To Dark Yellow Liquid

Molecular weight: 144.24

Ref: 3U-D5495

4'-Methylacetophenone-d10

Controlled Product

CAS: 358730-83-3

Applications 4'-Methylacetophenone-d10 (CAS# 358730-83-3) is a useful isotopically labeled research compound.

Formula: C₉D₁₀O

Color and Shape: Neat

Molecular weight: 144.2367

Ref: TR-M275306