CymitQuimica logo

CAS 358730-95-7

:

Phen-2,3,5,6-d4-ol-d,4-nonyl- (9CI)

Description:
Phen-2,3,5,6-d4-ol-d,4-nonyl- (9CI), with the CAS number 358730-95-7, is a deuterated phenolic compound characterized by the presence of a nonyl group and deuterium isotopes at specific positions on the phenolic ring. The deuteration enhances its stability and alters its physical properties, making it useful in various analytical applications, particularly in NMR spectroscopy, where the presence of deuterium can improve signal clarity and resolution. This compound typically exhibits properties associated with phenols, such as being a weak acid and having the ability to form hydrogen bonds, which can influence its solubility and reactivity. The nonyl group contributes to its hydrophobic characteristics, potentially affecting its interaction with biological systems and its environmental behavior. Overall, this compound is of interest in research and industrial applications, particularly in fields involving organic synthesis, material science, and pharmaceuticals, where isotopic labeling can provide insights into reaction mechanisms and molecular interactions.
Formula:C15H19D5O
InChI:InChI=1S/C15H24O/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h10-13,16H,2-9H2,1H3/i10D,11D,12D,13D/hD
InChI key:IGFHQQFPSIBGKE-VQUAKUOWSA-N
SMILES:[2H]C1=C(C(=C(C(=C1CCCCCCCCC)[2H])[2H])O[2H])[2H]
Synonyms:
  • 4-N-Nonylphenol-2,3,5,6-D4,Od
Found 5 products.