CAS 35896-58-3
:2,3,4,5-Tetramethoxytoluene
Description:
2,3,4,5-Tetramethoxytoluene is an organic compound characterized by the presence of a toluene backbone with four methoxy (-OCH3) groups attached to the aromatic ring at the 2, 3, 4, and 5 positions. This substitution pattern significantly influences its chemical properties, including its solubility, reactivity, and potential applications. The presence of multiple methoxy groups enhances its electron-donating ability, which can affect its behavior in various chemical reactions, such as electrophilic aromatic substitution. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is generally soluble in organic solvents like ethanol and ether but may have limited solubility in water due to its hydrophobic toluene core. 2,3,4,5-Tetramethoxytoluene may be used in organic synthesis, as a reagent in chemical research, or in the development of functional materials. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H16O4
InChI:InChI=1/C11H16O4/c1-7-6-8(12-2)10(14-4)11(15-5)9(7)13-3/h6H,1-5H3
SMILES:Cc1cc(c(c(c1OC)OC)OC)OC
Synonyms:- 1,2,3,4-Tetramethoxy-5-methylbenzene
- 1,2,3,4-Tetramethoxy-5-methylbenzol
- Benzene, 1,2,3,4-Tetramethoxy-5-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3,4,5-Tetramethoxytoluene
CAS:Formula:C11H16O4Purity:>97.0%(GC)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:212.251,2,3,4-Tetramethoxy-5-methylbenzene
CAS:Formula:C11H16O4Purity:95%Color and Shape:LiquidMolecular weight:212.24231,2,3,4-Tetramethoxy-5-methylbenzene
CAS:1,2,3,4-Tetramethoxy-5-methylbenzenePurity:98%Molecular weight:212.24g/mol2,3,4,5-Tetramethoxytoluene
CAS:2,3,4,5-Tetramethoxytoluene is a chlorinated aromatic hydrocarbon that is produced by the chloromethylation of toluene. It can be used in the synthesis of isoquinoline compounds and grignard reagents. 2,3,4,5-Tetramethoxytoluene is also a precursor for the production of 2-chloro-1-(2-chlorophenyl)ethanol (CCPE), which is used as an intermediate for the production of various pesticides and herbicides. Tetramethoxytoluene has been shown to be toxic to fish in water at concentrations as low as 0.1 micrograms per liter. It also has a potential to cause environmental pollution because it reacts with peroxide and alkylates other organic compounds.
Formula:C11H16O4Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:212.24 g/mol2,3,4,5-Tetramethoxytoluene
CAS:Formula:C11H16O4Purity:98%Color and Shape:Liquid, No data available.Molecular weight:212.245




