CymitQuimica logo

CAS 35896-58-3

:

2,3,4,5-Tetramethoxytoluene

Description:
2,3,4,5-Tetramethoxytoluene is an organic compound characterized by the presence of a toluene backbone with four methoxy (-OCH3) groups attached to the aromatic ring at the 2, 3, 4, and 5 positions. This substitution pattern significantly influences its chemical properties, including its solubility, reactivity, and potential applications. The presence of multiple methoxy groups enhances its electron-donating ability, which can affect its behavior in various chemical reactions, such as electrophilic aromatic substitution. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is generally soluble in organic solvents like ethanol and ether but may have limited solubility in water due to its hydrophobic toluene core. 2,3,4,5-Tetramethoxytoluene may be used in organic synthesis, as a reagent in chemical research, or in the development of functional materials. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H16O4
InChI:InChI=1/C11H16O4/c1-7-6-8(12-2)10(14-4)11(15-5)9(7)13-3/h6H,1-5H3
InChI key:OIWAVVSMXFIBCD-UHFFFAOYSA-N
SMILES:Cc1cc(c(c(c1OC)OC)OC)OC
Synonyms:
  • 1,2,3,4-Tetramethoxy-5-methylbenzene
  • 1,2,3,4-Tetramethoxy-5-methylbenzol
  • Benzene, 1,2,3,4-Tetramethoxy-5-Methyl-
Found 6 products.