
CAS 35906-36-6
:Onjisaponin B
Description:
Onjisaponin B is a triterpenoid saponin derived from the root of the plant *Polygala tenuifolia*, commonly known for its traditional medicinal uses. This compound is characterized by its complex structure, which typically includes a steroid-like backbone with sugar moieties attached, contributing to its saponin properties. Onjisaponin B exhibits various biological activities, including anti-inflammatory, neuroprotective, and potential anti-cancer effects, making it of interest in pharmacological research. Its solubility in water is influenced by the glycosidic components, which can enhance its bioavailability. Additionally, Onjisaponin B may interact with cell membranes due to its amphiphilic nature, leading to various physiological effects. The compound's safety profile and therapeutic potential are subjects of ongoing studies, particularly in the context of traditional medicine and modern pharmacotherapy. Overall, Onjisaponin B represents a significant area of interest in natural product chemistry and its applications in health and medicine.
Formula:C75H112O35
InChI:InChI=1S/C75H112O35/c1-30-44(81)48(85)53(90)63(99-30)107-59-58(105-43(80)17-12-33-10-13-34(97-9)14-11-33)32(3)101-67(60(59)108-64-56(93)51(88)57(31(2)100-64)106-62-52(89)47(84)40(28-98-62)104-65-54(91)49(86)45(82)38(26-76)102-65)110-69(96)74-21-20-70(4,5)24-36(74)35-15-16-41-71(6)25-37(79)61(109-66-55(92)50(87)46(83)39(27-77)103-66)73(8,68(94)95)42(71)18-19-72(41,7)75(35,29-78)23-22-74/h10-15,17,30-32,36-42,44-67,76-79,81-93H,16,18-29H2,1-9H3,(H,94,95)/b17-12+/t30-,31-,32+,36-,37-,38+,39+,40+,41+,42+,44-,45-,46+,47-,48+,49-,50-,51-,52+,53+,54+,55+,56+,57-,58-,59-,60+,61-,62-,63-,64-,65-,66-,67-,71+,72+,73-,74-,75-/m0/s1
InChI key:QSTBHNPMHXYCII-KJCIHCEPSA-N
SMILES:C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@H]([C@H](O[C@H]([C@@H]2O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O[C@H]4[C@@H]([C@H]([C@@H](CO4)O[C@H]5[C@@H]([C@H]([C@H]([C@H](O5)CO)O)O)O)O)O)O)O)OC(=O)[C@@]67CC[C@@]8(C(=CC[C@H]9[C@]8(CC[C@@H]1[C@@]9(C[C@@H]([C@@H]([C@@]1(C)C(=O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O)C)C)[C@@H]6CC(CC7)(C)C)CO)C)OC(=O)/C=C/C1=CC=C(C=C1)OC)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Onjisaponin B
CAS:Onjisaponin B, derived from Radix Polygalae, can enhances autophagy and accelerates the degradation of mutant α-synuclein and huntingtin in PC-12 cells.Formula:C75H112O35Purity:95%~99%Color and Shape:PowderMolecular weight:1573.69Onjisaponin B
CAS:Onjisaponin B induces autophagy via the AMPK-mTOR signaling pathway, increases the NGF level and accelerates both the removal of mutant huntingtin and A53T α±-Formula:C75H112O35Purity:99.20% - 99.97%Color and Shape:SolidMolecular weight:1573.67Onjisaponin B
CAS:Onjisaponin B is a triterpenoid saponin that has been shown to have anti-angiogenic effects, neuroprotective properties, and autophagy inducing activity. Onjisaponin B has also been shown to inhibit the production of tumor necrosis factor-α (TNF-α) in cultured PC12 cells. The anti-inflammatory effects of this compound may be due to its ability to induce autophagy. This compound induces autophagy by activating the mechanistic target of rapamycin (mTOR) pathway, which leads to the induction of autophagy through the activation of AMP kinase. Onjisaponin B has been found in plants used in traditional Chinese medicine and other Asian countries.Formula:C75H112O35Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,573.67 g/mol




