CAS 35973-25-2

8-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

Description:

8-Nitro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid is a chemical compound characterized by its unique quinoline structure, which includes a nitro group and a carboxylic acid functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid group. The nitro group contributes to its reactivity, making it a candidate for various chemical transformations. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoline derivatives are known for their biological activity. Additionally, the compound may exhibit specific spectral characteristics in techniques such as UV-Vis and NMR spectroscopy, aiding in its identification and analysis. Overall, 8-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid is a compound of interest in both synthetic and medicinal chemistry due to its distinctive functional groups and structural features.

Formula: C₁₀H₆N₂O₅

InChI: InChI=1/C10H6N2O5/c13-9-5-2-1-3-7(12(16)17)8(5)11-4-6(9)10(14)15/h1-4H,(H,11,13)(H,14,15)

SMILES: c1cc2c(c(c1)N(=O)=O)[nH]cc(c2=O)C(=O)O

Synonyms:

• 3-Quinolinecarboxylic Acid, 4-Hydroxy-8-Nitro-
• 4-Hydroxy-8-nitroquinoline-3-carboxylic acid

DNA2 inhibitor C5

CAS: 35973-25-2

DNA2 inhibitor C5 is a specific cancer sensitizer with an IC50 of 20 μM, targeting multiple DNA2 activities.

Formula: C₁₀H₆N₂O₅

Purity: 99.05%

Color and Shape: Solid

Molecular weight: 234.16

Ref: TM-T15146

3-QUINOLINECARBOXYLICACID, 4-HYDROXY-8-NITRO-

CAS: 35973-25-2

Formula: C₁₀H₆N₂O₅

Purity: 95%

Molecular weight: 234.1650

Ref: IN-DA0037LR

DNA2 inhibitor C5

CAS: 35973-25-2

DNA2 inhibitor C5

Purity: ≥98%

Molecular weight: 234.16g/mol

Ref: 54-BUP08515

4-Hydroxy-8-nitroquinoline-3-carboxylic acid

CAS: 35973-25-2

4-Hydroxy-8-nitroquinoline-3-carboxylic acid

Purity: ≥95%

Molecular weight: 234.17g/mol

Ref: 54-OR183494

4-Hydroxy-8-nitroquinoline-3-carboxylic acid

CAS: 35973-25-2

Purity: 95%

Molecular weight: 234.027671292

Ref: 10-F551072

4-Hydroxy-8-nitro-3-quinolinecarboxylic acid

CAS: 35973-25-2

4-Hydroxy-8-nitro-3-quinolinecarboxylic acid is a cancer treatment that inhibits the growth of cancer cells. It inhibits the production of DNA, RNA, and protein and prevents cell division by binding to DNA. 4-Hydroxy-8-nitro-3-quinolinecarboxylic acid also prevents the synthesis of proteins and nucleic acids. This drug has been shown to be effective for the treatment of leukemia, lymphoma, breast cancer, prostate cancer, and other cancers.

Formula: C₁₀H₆N₂O₅

Purity: Min. 95%

Molecular weight: 234.16 g/mol

Ref: 3D-KBA97325