CAS 35973-25-2
:8-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
Description:
8-Nitro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid is a chemical compound characterized by its unique quinoline structure, which includes a nitro group and a carboxylic acid functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid group. The nitro group contributes to its reactivity, making it a candidate for various chemical transformations. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoline derivatives are known for their biological activity. Additionally, the compound may exhibit specific spectral characteristics in techniques such as UV-Vis and NMR spectroscopy, aiding in its identification and analysis. Overall, 8-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid is a compound of interest in both synthetic and medicinal chemistry due to its distinctive functional groups and structural features.
Formula:C10H6N2O5
InChI:InChI=1/C10H6N2O5/c13-9-5-2-1-3-7(12(16)17)8(5)11-4-6(9)10(14)15/h1-4H,(H,11,13)(H,14,15)
SMILES:c1cc2c(c(c1)N(=O)=O)[nH]cc(c2=O)C(=O)O
Synonyms:- 3-Quinolinecarboxylic Acid, 4-Hydroxy-8-Nitro-
- 4-Hydroxy-8-nitroquinoline-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
DNA2 inhibitor C5
CAS:DNA2 inhibitor C5 is a specific cancer sensitizer with an IC50 of 20 μM, targeting multiple DNA2 activities.Formula:C10H6N2O5Purity:99.05%Color and Shape:SolidMolecular weight:234.16Ref: TM-T15146
1mg57.00€1mL*10mM (DMSO)112.00€5mg113.00€10mg178.00€25mg334.00€50mg497.00€100mg692.00€4-Hydroxy-8-nitroquinoline-3-carboxylic acid
CAS:4-Hydroxy-8-nitroquinoline-3-carboxylic acidFormula:C10H6N2O5Purity:≥95%Molecular weight:234.165043-QUINOLINECARBOXYLICACID, 4-HYDROXY-8-NITRO-
CAS:Formula:C10H6N2O5Purity:95%Molecular weight:234.16504-Hydroxy-8-nitro-3-quinolinecarboxylic acid
CAS:4-Hydroxy-8-nitro-3-quinolinecarboxylic acid is a cancer treatment that inhibits the growth of cancer cells. It inhibits the production of DNA, RNA, and protein and prevents cell division by binding to DNA. 4-Hydroxy-8-nitro-3-quinolinecarboxylic acid also prevents the synthesis of proteins and nucleic acids. This drug has been shown to be effective for the treatment of leukemia, lymphoma, breast cancer, prostate cancer, and other cancers.Formula:C10H6N2O5Purity:Min. 95%Molecular weight:234.16 g/mol




