CAS 360-65-6: Glycodeoxycholic acid
Description:Glycodeoxycholic acid is a bile acid derivative that plays a significant role in the digestion and absorption of fats in the intestine. It is a conjugated bile acid formed by the conjugation of deoxycholic acid with glycine. This compound is typically found in the bile of mammals and is involved in the emulsification of dietary lipids, facilitating their absorption. Glycodeoxycholic acid exhibits amphipathic properties, possessing both hydrophilic and hydrophobic regions, which allows it to interact with lipid molecules effectively. It is also known to influence various physiological processes, including cholesterol metabolism and gut microbiota composition. In terms of its chemical structure, it contains a steroid nucleus with hydroxyl groups that contribute to its solubility and functionality. Glycodeoxycholic acid has been studied for its potential therapeutic applications, particularly in liver diseases and metabolic disorders. However, its use in clinical settings requires careful consideration due to its biological effects and interactions within the body.
Formula:C26H43NO5
InChI:InChI=1S/C26H43NO5/c1-15(4-9-23(30)27-14-24(31)32)19-7-8-20-18-6-5-16-12-17(28)10-11-25(16,2)21(18)13-22(29)26(19,20)3/h15-22,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16-,17-,18+,19-,20+,21+,22+,25+,26-/m1/s1
InChI key:InChIKey=WVULKSPCQVQLCU-BUXLTGKBSA-N
SMILES:O=C(O)CNC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C
- Synonyms:
- 3α,12α-Dihydroxy-5β-cholanic acid-24-glycine
- 5β-Cholan-24-amide, N-(carboxymethyl)-3α,12α-dihydroxy-
- Cholane, glycine deriv.
- Deoxycholic acid glycine conjugate
- Deoxycholylglycine
- Deoxyglycocholic acid
- Glycine, N-(3α,12α-dihydroxy-5β-cholan-24-oyl)-
- Glycine, N-[(3α,5β,12α)-3,12-dihydroxy-24-oxocholan-24-yl]-
- Glycodeoxycholic acid
- Glycodesoxycholic acid
- See more synonyms
- Glycyldeoxycholic acid
- N-(3,12-dihydroxy-24-oxocholan-24-yl)glycine
- N-[(3alpha,5beta,12alpha)-3,12-dihydroxy-24-oxocholan-24-yl]glycine
- N-[(3alpha,5beta,8xi,9xi,10alpha,12alpha,14xi,17xi,20xi)-3,12-dihydroxycholan-24-yl]glycine
- N-[(3α,5β,12α)-3,12-Dihydroxy-24-oxocholan-24-yl]glycine
- Zinc 08837267
