CAS 360-65-6
:Glycodeoxycholic acid
Description:
Glycodeoxycholic acid is a bile acid derivative that plays a significant role in the digestion and absorption of fats in the intestine. It is a conjugated bile acid formed by the conjugation of deoxycholic acid with glycine. This compound is typically found in the bile of mammals and is involved in the emulsification of dietary lipids, facilitating their absorption. Glycodeoxycholic acid exhibits amphipathic properties, possessing both hydrophilic and hydrophobic regions, which allows it to interact with lipid molecules effectively. It is also known to influence various physiological processes, including cholesterol metabolism and gut microbiota composition. In terms of its chemical structure, it contains a steroid nucleus with hydroxyl groups that contribute to its solubility and functionality. Glycodeoxycholic acid has been studied for its potential therapeutic applications, particularly in liver diseases and metabolic disorders. However, its use in clinical settings requires careful consideration due to its biological effects and interactions within the body.
Formula:C26H43NO5
InChI:InChI=1S/C26H43NO5/c1-15(4-9-23(30)27-14-24(31)32)19-7-8-20-18-6-5-16-12-17(28)10-11-25(16,2)21(18)13-22(29)26(19,20)3/h15-22,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16-,17-,18+,19-,20+,21+,22+,25+,26-/m1/s1
InChI key:InChIKey=WVULKSPCQVQLCU-BUXLTGKBSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@](CC3)(C[C@H](O)CC4)[H])(C[C@@H]1O)[H])[H])(CC[C@@]2([C@@H](CCC(NCC(O)=O)=O)C)[H])[H]
Synonyms:- 3α,12α-Dihydroxy-5β-cholanic acid-24-glycine
- 5β-Cholan-24-amide, N-(carboxymethyl)-3α,12α-dihydroxy-
- Cholane, glycine deriv.
- Deoxycholic acid glycine conjugate
- Deoxycholylglycine
- Deoxyglycocholic acid
- Glycine, N-(3α,12α-dihydroxy-5β-cholan-24-oyl)-
- Glycine, N-[(3α,5β,12α)-3,12-dihydroxy-24-oxocholan-24-yl]-
- Glycodeoxycholic acid
- Glycodesoxycholic acid
- Glycyldeoxycholic acid
- N-(3,12-dihydroxy-24-oxocholan-24-yl)glycine
- N-[(3alpha,5beta,12alpha)-3,12-dihydroxy-24-oxocholan-24-yl]glycine
- N-[(3alpha,5beta,8xi,9xi,10alpha,12alpha,14xi,17xi,20xi)-3,12-dihydroxycholan-24-yl]glycine
- N-[(3α,5β,12α)-3,12-Dihydroxy-24-oxocholan-24-yl]glycine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 14 products.
N-[(3α,5β,12α)-3,12-Dihydroxy-24-oxocholan-24-yl]glycine
CAS:Formula:C26H43NO5Purity:97%Color and Shape:SolidMolecular weight:449.6233Glycodeoxycholic Acid
CAS:Formula:C26H43NO5Color and Shape:White To Off-White SolidMolecular weight:449.63Glycodeoxycholic-d6-acid (2,2,4,4-d4; glycine-2,2-d2)
CAS:Formula:C26H37D6NO5Purity:97 atom % DMolecular weight:455.35178GLYCODEOXYCHOLIC ACID
CAS:Glycodeoxycholic Acid is a bile acid that induces severe pancreatitis in rats. It can induce the apoptosis of SMMC-7721 cells.Formula:C26H43NO5Purity:99.49% - 99.89%Color and Shape:White SolidMolecular weight:449.62Glycodeoxycholic Acid-D5
CAS:Controlled ProductApplications Glycodeoxycholic acid-D5 is a labelled analogue of Glycodeoxycholic acid (G641400).
Formula:C26H38D5NO5Color and Shape:NeatMolecular weight:454.65Glycodeoxycholic acid
CAS:Controlled ProductGlycodeoxycholic acid is a bile acid derivative, which is synthesized in the liver from cholesterol. It functions primarily as a signaling molecule with multiple physiological roles in the human body. This compound is conjugated, enhancing its solubility and facilitating its transport within the gastrointestinal tract. Glycodeoxycholic acid acts as an agonist for specific receptors such as the farnesoid X receptor (FXR), playing a vital role in the regulation of bile acid synthesis, lipid metabolism, and glucose homeostasis.Formula:C26H43NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:449.62 g/mol










