CAS 36016-40-7
:O-(Mesitylsulfonyl)Hydroxylamine
Description:
O-(Mesitylsulfonyl)hydroxylamine is a chemical compound characterized by its unique structure, which includes a hydroxylamine functional group and a mesitylsulfonyl moiety. This compound typically appears as a solid and is known for its role as a reagent in organic synthesis, particularly in the formation of amines and in various coupling reactions. It exhibits good solubility in polar organic solvents, making it versatile for laboratory applications. The presence of the mesitylsulfonyl group enhances its stability and reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, O-(Mesitylsulfonyl)hydroxylamine can act as a protecting group for amines, facilitating the selective modification of functional groups in complex organic molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Overall, its distinctive properties make it a valuable tool in synthetic organic chemistry.
Formula:C9H13NO3S
InChI:InChI=1/C9H13NO3S/c1-6-4-7(2)9(8(3)5-6)14(12,13)10-11/h4-5,10-11H,1-3H3
SMILES:Cc1cc(C)c(c(C)c1)S(=O)(=O)NO
Synonyms:- O-mesitylenesulphonylhydroxylamine
- O-Mesitylenesulfonylhydroxylamine
- 2-[(Aminooxy)Sulfonyl]-1,3,5-Trimethylbenzene
- N-hydroxy-2,4,6-trimethylbenzenesulfonamide
- O-(2,4,6-Trimethylphenyl)sulfonylhydroxylamine
- amino 2,4,6-trimethylbenzenesulfonate
- O-Mesitylenesulfonyl
- MSH, O-(Mesitylenesulfonyl)hydroxylamine
- amino 2,4,6-trimethylbenzene-1-sulfonate
- O-(2,4,6-Trimethylbenzenesulfonyl)hydroxylamine
- O-(MESITYLSULFONYL)HYDROXYLAMINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
O-Mesitylenesulfonylhydroxylamine - 10-65% water
CAS:Aminating ReagentFormula:C9H13NO3SPurity:Min. 70 Area-%Color and Shape:Colorless PowderMolecular weight:215.27 g/molO-Mesitylenesulfonylhydroxylamine
CAS:O-Mesitylenesulfonylhydroxylamine is an amine that has been synthesized by reacting trifluoroacetic acid with anilines. The compound has a molecular weight of 242.2 and a melting point of 111°C. It has been shown to have antitumor activity in lymphocytic leukemia cells and human breast cancer cells, MDA-MB-231, through inhibition of the enzyme phosphotriesterase (PTE). OMSH inhibits the PTE enzyme by binding to the phosphate group from ATP, which is required for PTE activation. This inhibition leads to reduced protein synthesis and cell death due to apoptosis.Formula:C9H13NO3SPurity:Min. 95%Color and Shape:PowderMolecular weight:215.27 g/mol
