CAS 36023-58-2
:Diaminodicyanopyrazine; 97%
Description:
Diaminodicyanopyrazine, with the CAS number 36023-58-2, is a chemical compound characterized by its unique structure, which includes two amino groups and two cyano groups attached to a pyrazine ring. This compound typically appears as a solid and is known for its high stability and solubility in polar solvents. It exhibits properties that make it useful in various applications, including organic synthesis and as a potential precursor in the development of advanced materials. The presence of multiple functional groups allows for diverse reactivity, making it a valuable intermediate in chemical reactions. Additionally, its purity level of 97% indicates a high degree of refinement, which is crucial for ensuring consistent performance in laboratory and industrial settings. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Overall, diaminodicyanopyrazine is an important compound in the field of chemistry, particularly in research and development contexts.
Formula:C6H4N6
InChI:InChI=1/C6H4N6/c7-1-3-4(2-8)12-6(10)5(9)11-3/h(H2,9,11)(H2,10,12)
SMILES:C(#N)c1c(C#N)nc(c(N)n1)N
Synonyms:- 5,6-Diamino-2,3-dicyanopyrazine (mixed isomer)
- 5,6-Diaminopyrazine-2,3-Dicarbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5,6-Diamino-2,3-dicyanopyrazine
CAS:Formula:C6H4N6Purity:>98.0%(N)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:160.145,6-Diaminopyrazine-2,3-Dicarbonitrile
CAS:5,6-Diaminopyrazine-2,3-DicarbonitrileFormula:C6H4N6Purity:98%Molecular weight:160.142,3-Pyrazinedicarbonitrile, 5,6-diamino-
CAS:Formula:C6H4N6Purity:98%Color and Shape:SolidMolecular weight:160.13625,6-Diamino-2,3-dicyanopyrazine
CAS:5,6-Diamino-2,3-dicyanopyrazine (5,6-DDA) is a synthetic compound that has been shown to emit in the visible region. The emission spectrum of 5,6-DDA shows three peaks at 599 nm, 614 nm, and 637 nm. The molecular orbitals of 5,6-DDA are calculated to be sp2 hybridized with a singlet ground state. This molecule has been shown to form imines with aniline and pyrrole in the presence of chloride ions. It also forms a zn complex with zinc chloride and nitrate ions. The thermolysis of furyl derivatives produces the corresponding anions. 5,6-DDA can also undergo a photochemical reaction with chlorine gas to form its molecular ion at 637 nm.Formula:C6N4N6Purity:(%) Min. 98%Color and Shape:PowderMolecular weight:160.14 g/mol5,6-Diaminopyrazine-2,3-dicarbonitrile
CAS:Formula:C6H4N6Purity:98%Color and Shape:SolidMolecular weight:160.14




