CymitQuimica logo

CAS 36070-75-4

:

2-Chloro-5-cyanopyrazine

Description:
2-Chloro-5-cyanopyrazine is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at opposite positions. The presence of a chlorine atom at the 2-position and a cyano group (-C≡N) at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to light yellow solid and is soluble in polar organic solvents. It exhibits moderate stability under standard conditions but may undergo reactions typical of halogenated compounds, such as nucleophilic substitution. The cyano group enhances its reactivity, making it useful in various synthetic applications, including the preparation of pharmaceuticals and agrochemicals. Additionally, 2-chloro-5-cyanopyrazine can serve as an important intermediate in organic synthesis, particularly in the development of biologically active molecules. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C5H2ClN3
InChI:InChI=1/C5H2ClN3/c6-5-3-8-4(1-7)2-9-5/h2-3H
InChI key:GTYRFWMSDBGPTI-UHFFFAOYSA-N
SMILES:C(#N)c1cnc(cn1)Cl
Synonyms:
  • 5-Chloropyrazine-2-carbonitrile
Found 7 products.