CAS 36070-75-4
:2-Chloro-5-cyanopyrazine
Description:
2-Chloro-5-cyanopyrazine is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at opposite positions. The presence of a chlorine atom at the 2-position and a cyano group (-C≡N) at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to light yellow solid and is soluble in polar organic solvents. It exhibits moderate stability under standard conditions but may undergo reactions typical of halogenated compounds, such as nucleophilic substitution. The cyano group enhances its reactivity, making it useful in various synthetic applications, including the preparation of pharmaceuticals and agrochemicals. Additionally, 2-chloro-5-cyanopyrazine can serve as an important intermediate in organic synthesis, particularly in the development of biologically active molecules. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C5H2ClN3
InChI:InChI=1/C5H2ClN3/c6-5-3-8-4(1-7)2-9-5/h2-3H
SMILES:C(#N)c1cnc(cn1)Cl
Synonyms:- 5-Chloropyrazine-2-carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Chloropyrazine-2-carbonitrile
CAS:5-Chloropyrazine-2-carbonitrileFormula:C5H2ClN3Purity:97%Color and Shape:SolidMolecular weight:139.542482-CHLORO-5-CYANOPYRAZINE
CAS:Formula:C5H2ClN3Purity:97%Color and Shape:SolidMolecular weight:139.54252-CHLORO-5-CYANOPYRAZINE
CAS:2-CHLORO-5-CYANOPYRAZINEFormula:C5H2ClN3Purity:≥98%Molecular weight:139.542-Chloro-5-cyanopyrazine
CAS:Formula:C5H2ClN3Purity:95.0%Color and Shape:Solid, Yellow powderMolecular weight:139.542-CHLORO-5-CYANOPYRAZINE
CAS:2-CHLORO-5-CYANOPYRAZINE (5-Chloropyrazine-2-carbonitrile) is an active biochemical.Formula:C5H2ClN3Purity:99.59%Color and Shape:SolidMolecular weight:139.542-Chloro-5-cyanopyrazine
CAS:2-Chloro-5-cyanopyrazine is a synthetic compound that has been shown to have anti-cancer properties. It is an acceptor molecule that has a nucleophilic character and can react with electrophiles to form covalent bonds. This compound has been shown to selectively inhibit the growth of cancer cells in vitro. The mechanism of action is not yet clear, but it may be due to its ability to induce apoptosis and arrest cell cycle progression at the G1 phase. 2-Chloro-5-cyanopyrazine also has the potential for use as an analytical reagent because of its high solubility in organic solvents. In addition, this compound can be used as a copper donor in reactions involving carboxylic acids or other nucleophiles. 2-Chloro-5-cyanopyrazine can be synthesized from benzene and chloropicrin in the presence of copper(II)Formula:C5H2ClN3Purity:Min. 95%Color and Shape:Off-White To Yellow SolidMolecular weight:139.54 g/mol5-Chloropyrazine-2-carbonitrile
CAS:5-Chloropyrazine-2-carbonitrileFormula:C5H2ClN3Purity:97%Molecular weight:139.54






