CAS 360768-37-2

1H-Pyrrole-2,5-dione,1-(ethyl-d5)-

Description:

1H-Pyrrole-2,5-dione, 1-(ethyl-d5)-, with the CAS number 360768-37-2, is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of the d5 label indicates that the ethyl group attached to the pyrrole is deuterated, meaning that it contains deuterium (a stable isotope of hydrogen) instead of regular hydrogen atoms. This modification can influence the compound's physical and chemical properties, such as its stability, reactivity, and isotopic labeling in various applications, including NMR spectroscopy. The compound is likely to exhibit typical pyrrole-like reactivity, including electrophilic substitution and potential interactions with various nucleophiles. Additionally, due to its unique structure, it may have applications in organic synthesis, pharmaceuticals, or materials science. As with many nitrogen-containing heterocycles, it may also display interesting biological activities, making it a subject of interest in medicinal chemistry.

Formula: C₆H₂D₅NO₂

InChI: InChI=1S/C6H7NO2/c1-2-7-5(8)3-4-6(7)9/h3-4H,2H2,1H3/i1D3,2D2

InChI key: HDFGOPSGAURCEO-ZBJDZAJPSA-N

SMILES: [2H]C([2H])([2H])C([2H])([2H])N1C(=O)C=CC1=O

Synonyms:

• N-Ethyl-D5-Maleimide

N-Ethylmaleimide-d5

CAS: 360768-37-2

N-Ethylmaleimide-d5

Formula: C₆H₂D₅NO₂

Purity: 99%

Molecular weight: 130.16

Ref: 54-DE3273

N-Ethylmaleimide-D5

CAS: 360768-37-2

N-Ethylmaleimide-D5 is the deuterated form of N-Ethylmaleimide (T3088) (NEM). N-Ethylmaleimide (T3088) acts as an alkylating agent for free thiol groups and serves as an inhibitor of cysteine proteinases. It specifically inhibits phosphate transport within mitochondria. Additionally, N-Ethylmaleimide (T3088) functions as an inhibitor of deubiquitinating enzymes (deubiquitinatingenzyme).

Formula: C₆H₇NO₂

Molecular weight: 130.16

Ref: TM-TMID-0858

N-Ethyl-d5-maleimide

CAS: 128-53-0, 360768-37-2

Purity: 99 atom % D

Color and Shape: White Solid

Molecular weight: 130.16

Ref: 3U-D6141

N-Ethyl-d5-maleimide

Controlled Product

CAS: 360768-37-2

Applications N-Ethyl-d5-maleimide (CAS# 360768-37-2) is a useful isotopically labeled research compound.

Formula: C₆H₂D₅NO₂

Color and Shape: Neat

Molecular weight: 130.16

Ref: TR-E817901