CymitQuimica logo

CAS 360768-57-6

:

1,1'-Biphenyl, 4-ethynyl-4'-propyl-

Description:
1,1'-Biphenyl, 4-ethynyl-4'-propyl- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an ethynyl group (-C≡CH) at one of the para positions and a propyl group (-C3H7) at the other para position contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is relatively hydrophobic due to the aromatic nature of the biphenyl structure, making it soluble in organic solvents but insoluble in water. The compound may exhibit interesting electronic and optical properties, making it of interest in materials science, particularly in organic electronics and photonics. Additionally, its synthesis and reactivity can be influenced by the substituents on the biphenyl framework, which can affect its stability and interaction with other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C17H16
InChI:InChI=1S/C17H16/c1-3-5-15-8-12-17(13-9-15)16-10-6-14(4-2)7-11-16/h2,6-13H,3,5H2,1H3
InChI key:ZBSZCHDBZRCUES-UHFFFAOYSA-N
SMILES:CCCC1=CC=C(C=C1)C2=CC=C(C=C2)C#C
Found 5 products.