CymitQuimica logo

CAS 361-63-7

:

Bis(4-fluorophenyl) acetic acid

Description:
Bis(4-fluorophenyl)acetic acid, with the CAS number 361-63-7, is an organic compound characterized by its structure, which features two 4-fluorophenyl groups attached to a central acetic acid moiety. This compound typically appears as a white to off-white solid and is known for its aromatic properties due to the presence of the fluorinated phenyl rings. The fluorine substituents enhance the compound's lipophilicity and can influence its reactivity and biological activity. Bis(4-fluorophenyl)acetic acid is soluble in organic solvents but has limited solubility in water, which is common for many aromatic compounds. It is often used in chemical synthesis and research, particularly in the development of pharmaceuticals and agrochemicals. The presence of the acetic acid functional group allows for potential interactions in various chemical reactions, making it a versatile compound in organic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H10F2O2
InChI:InChI=1/C14H10F2O2/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13H,(H,17,18)
InChI key:MCDCIWAVBWPRSP-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(c1ccc(cc1)F)C(=O)O)F
Synonyms:
  • Bis-(4-Fluororphenyl)-Acetic Acid
  • bis(4-fluorophenyl)acetic acid
Found 5 products.