CymitQuimica logo

CAS 361-73-9

:

2-(2,2,2-Trifluoroacetyl)cyclopentanone

Description:
2-(2,2,2-Trifluoroacetyl)cyclopentanone, with the CAS number 361-73-9, is an organic compound characterized by its cyclopentanone structure substituted with a trifluoroacetyl group. This compound typically exhibits a polar nature due to the presence of the electronegative fluorine atoms, which can influence its reactivity and solubility in various solvents. The trifluoroacetyl group is known for its strong electron-withdrawing properties, which can enhance the acidity of adjacent hydrogen atoms and affect the compound's behavior in chemical reactions. Additionally, the presence of the cyclopentanone ring contributes to its unique structural and stereochemical properties. This compound may be utilized in various synthetic applications, particularly in the field of organic chemistry, where it can serve as an intermediate in the synthesis of more complex molecules. Its physical properties, such as boiling point and melting point, are influenced by the molecular structure and the presence of the trifluoroacetyl group, making it an interesting subject for further study in chemical research and applications.
Formula:C7H7F3O2
InChI:InChI=1S/C7H7F3O2/c8-7(9,10)6(12)4-2-1-3-5(4)11/h4H,1-3H2
InChI key:InChIKey=UWMPYUXPRBDDNF-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1C(=O)CCC1
Synonyms:
  • 2-(2,2,2-Trifluoroacetyl)cyclopentan-1-one
  • 2-(2,2,2-Trifluoroacetyl)cyclopentanone
  • 2-(Trifluoroacetyl)cyclopentan-1-one
  • 2-(Trifluoroacetyl)cyclopentanone
  • Cyclopentanone, 2-(trifluoroacetyl)-
  • Cyclopentanone,2-(trifluoroacetyl)- (7CI,8CI,9CI)
  • Cyclopentanone, 2-(2,2,2-trifluoroacetyl)-
Found 1 products.