CymitQuimica logo

CAS 361179-31-9

:

3-(6,6-dimethyl-3-oxotetrahydro-2H-pyran-2-yl)-3-hydroxy-1,3-dihydro-2H-indol-2-one

Description:
The chemical substance known as 3-(6,6-dimethyl-3-oxotetrahydro-2H-pyran-2-yl)-3-hydroxy-1,3-dihydro-2H-indol-2-one, with the CAS number 361179-31-9, is characterized by its complex molecular structure, which includes both indole and tetrahydropyran moieties. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents. It may display biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of functional groups like hydroxyl and carbonyl contributes to its reactivity and potential interactions in biological systems. Additionally, the dimethyl substitution on the tetrahydropyran ring may influence its steric and electronic properties, affecting its overall stability and reactivity. As with many organic compounds, its behavior can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties, including its spectral characteristics and potential applications in various fields.
Formula:C15H17NO4
InChI:InChI=1/C15H17NO4/c1-14(2)8-7-11(17)12(20-14)15(19)9-5-3-4-6-10(9)16-13(15)18/h3-6,12,19H,7-8H2,1-2H3,(H,16,18)
InChI key:QXTJREVNZXWUPV-UHFFFAOYSA-N
SMILES:CC1(C)CCC(=O)C(C2(c3ccccc3N=C2O)O)O1
Found 2 products.